Search PubMed⌕ Search

Biomedical subjects

Ronald G. Cavell

Publications and source records attributed to Ronald G. Cavell.

8 recordsLinked to original sources

Chemistry of Diazaphospholephosphines. 2. Exocyclic Phosphine-Sulfido, -Selenido, and -Imido Derivatives of a Diazaphospholephosphine System. Crystal and Molecular Structures of Two Diazaphospholephosphine Imines: 4-(Difluoro((p-cyanotetrafluorophenyl)imino)phosphorano)-2,5-dimethyl-2H-1,2,3sigma(2)-diazaphosphole and 4-(Bis(dimethylamino)(((pentamethylcyclopentadienyl)dichlorotitanio)imino)phosphorano)-2,5-dimethyl-2H-1,2,3sigma(2)-diazaphosphole.

The substituted-exo-phosphine (X = F, NMe(2), OCH(2)CF(3)) diazaphospholephosphines are exclusively oxidized at this center with either chalcogens (S, Se) or azides to phosphoranodiazaphospholes. Oxidation imparts a dramatic upfield shift of the phosphorus NMR signals and an increase in the (1)J(PC) coupling constants within the ring. (Difluorophosphino)diazaphosphole was also oxidized with selected amines using diethyl azodicarboxylate (DAD) as the coupling agent. Bulky amines (e.g., 2,4,6-tri-tert-butylaniline (mes)) gave the monomeric iminophosphorane whereas less bulky amines (p-toluidine) formed mostly the cyclic diazadiphosphetidine. The crystal and molecular structure of 4-(difluoro((p-cyanotetrafluorophenyl)imino)phosphorano)-2,5-dimethyl-2H-1,2,3sigma(2)-diazaphosphole was determined: triclinic, P&onemacr; (No. 2), a = 7.2744(15) Å, b = 10.087(4) Å, c = 10.566(2) Å, alpha = 66.62(2) degrees, beta = 77.60(2) degrees, gamma = 78.14(3) degrees, V = 688.8(4) Å(3), Z = 2. Final indices are R(1) = 0.0368 and wR(2) = 0.0968, and for all data, R(1) = 0.0478, wR(2) = 0.1033, and GOF = 1.067. The structure revealed two planar ring systems consisting of the diazaphosphole and the p-tetrafluorophenyl (tfbn) ring with an angle of 26.3 degrees between the rings. The angle about the phosphine imine nitrogen (i.e., P=N-tfbn) is relatively open (141.2(2) degrees ), and the P=N bond length is relatively short (1.514(2) Å). (((Trimethylsilyl)imino)(bis(dimethylamino))phosphorano)diazaphosphole gave, with CpTiCl(3), [(eta(5)-C(5)Me(5))TiCl(2)(N=P(NMe(2))(2)(2,5-dimethyl-2H-1,2,3sigma(2)-diazaphosphol-4-yl))], which was also characterized structurally: monoclinic, P2(1) (No. 4), a = 11.9477(11) Å, b = 8.4757(6) Å, c = 12.7567(11) Å, beta = 108.824(8) degrees, V = 1222.7(2) Å(3), Z = 2. Final indices are R(1) = 0.0630 and wR(2) = 0.1593, and for all data, R(1) = 0.0768, wR(2) = 0.1973, and GOF = 1.081. The Ti-N-P angle of 161.0(5) degrees was large, and the P=N distance (1.592(6) Å) and the Ti-N distance (1.781(6) Å) were both slightly shorter than those in similar titanium complexes. The P-N single bond distances between the exo-phosphorus atom and the attached dimethylamino groups were also short (1.649 Å (average)). These short values suggest delocalized bonding character throughout the metal-ligand framework, possibly a consequence of additional conjugation through the diazaphosphole ring.

Journal Article↗

Chemistry of Diazaphospholephosphines. 1. Preparation of Substituted 4-(Phosphino)-2,5-dimethyl-2H-1,2,3sigma(2)-diazaphospholes, Bifunctional Phosphines with Dicoordinate and Tricoordinate Phosphorus(III) Centers. Chromium(0) and Molybdenum(0) Difluorophosphine Complexes.

An improved preparation of 4-(dichlorophosphino)-2,5-dimethyl-2H-1,2,3sigma(2)-diazaphosphole (1) is described. Replacement of the two chlorine substituents with two fluorine (2), dimethylamino (3), diethylamino (4), bis(n-propyl)amine (5), pyrazole (9), 3,5-dimethylpyrazole (10), 2,2,2-trifluoroethoxy (11), phenoxy (12), pentafluorophenoxy (13), 2,6-difluorophenoxy (14), and pentafluorobenzoxy (15) substituents has been accomplished to create a large suite of potentially bifunctional phosphorus(III) ligands with two- and three-coordinate P centers spanning a range of basicity and steric bulk at the exo-phosphorus center. Bulky secondary amines (such as diisopropylamine, dibenzylamine, and iminodibenzyl) replaced only one chlorine atom to give asymmetric 4-(chloroaminophosphino)-2,5-dimethyl-2H-1,2,3sigma(2)-diazaphospholes (6, 7, and 8, respectively). The asymmetric substitution creates a diastereotopic center in both 6 and 7 which is observed as fluxional NMR behavior at room temperature. Similar diastereotopic induced behavior was observed in the substituent methylene protons of 11. Coordination studies of the fluorinated phosphole (L = 2) with Cr(0) and Mo(0) gave Cr(CO)(5)L (16), cis-Mo(CO)(4)L(2) (17), and fac-Mo(CO)(3)L(3) (18) (where L = 4-(difluorophosphino)-2,5-dimethyl-2H-1,2,3sigma(2)-diazaphosphole). The fluoro ligand displays a behavior which is similar to that of PF(3) and phosphites.

Journal Article↗

Complexes of Multifunctional Phosphorus Ligands. Rhenium(V) Complexes of the Multidentate Phenoxyphosphine Ligands Bis(o-trimethylsilyloxyphenyl)phenylphosphine and Tris(o-trimethylsilyloxyphenyl)phosphine. Stepwise Elimination of Me(3)SiX (X = Cl, OEt) from the Metal-Ligand System.

The silylated aryloxo ligands bis(o-silyloxyphenyl)phenylphosphine (abbreviated PhP{OT}(2)) and tris(o-trimethylsilyloxyphenyl)phosphine (abbreviated P{OT}(3), where T = Me(3)Si) were prepared. Complexation reactions with O=ReCl(2)(OEt)(PPh(3))(2) and O=ReCl(3)(PPh(3))(2) proceed by displacement of one PPh(3) and the subsequent stepwise replacement of the OEt and/or Cl substituents. The new complex Re(O)Cl(2)[kappa(2)-(P,O)-(PhP{O}{OT})](PPh(3)), formed by elimination of Me(3)SiOEt, exists in diastereomeric cis and trans forms. Elimination of a second equivalent of Me(3)SiCl gives Re(O)Cl[kappa(3)-(P,O,O)-(PhP{O}(2))](PPh(3)). Similarly P{OT}(3) converts Re(O)Cl(2)(OEt)(PPh(3))(2) to ReOCl(2)[kappa(2)-(P,O)-(P{O}{OT}(2))](PPh(3)) (5) (structurally characterized as 5.0.875CH(2)Cl(2)): crystal data; triclinic P&onemacr;, a = 14.302(4) Å, b = 18.734(2) Å, c = 17.639(4) Å, alpha = 80.950(12) degrees, beta = 80.12(2) degrees, gamma = 81.76(2) degrees, Z = 4. Final R(1) and wR(2) values are 0.0852 and 0.1525, respectively on F(o)(2) > 2sigma(F(o)(2)) data (or 0.1948 and 0.2019 on all data). The phenoxy phosphine ligand in 5 is bound via P and one O to Re. The P atoms are mutually cis to each other and to the terminal oxygen on Re. Two ortho-trimethylsiloxy substituted phenyl rings dangle from the coordinated phosphorus atom. Complex 5 can be converted to Re(O)Cl[kappa(3)-(P,O,O)-(P{O}(2){OT})](PPh(3)) (6) by treatment with PPN(+) Cl(-) and 6 was also obtained by direct reaction of Re(O)Cl(3)(PPh(3))(2) with P{OT}(3) at higher temperatures. The complex 6 has been structurally characterized: crystal data triclinic, P&onemacr;, a = 10.1509(6) Å, b = 12.1123(8) Å, c = 16.2142(14) Å, alpha = 97.851(7) degrees, beta = 94.852(7) degrees, gamma = 96.889(6) degrees, Z = 2. Final R(1) and wR(2) values were 0.0303 and 0.0721 on F(o)(2) > 2sigma(F(o)(2)) data (or 0.0348 and 0.0742 on all data). The phenoxyphosphine ligand in 6 is bound facially to Re through P and two of the phenoxy oxygens. The Ph(3)P group and terminal oxygen atoms are cis to the oxygen atoms of the phenoxy ligands and the Cl lies trans to P. One trimethylsiloxyphenol group dangles. Careful hydrolysis of 6 gave Re(O)Cl[kappa(3)-(P,O,O)-(P{O}(2){OH})](PPh(3)) which was also formed during complexation reactions in moist solvent. Solution (31)P{(1)H} NMR demonstrated cis- or trans-(P,P) geometry for the complexes, which was confirmed in the two aforementioned cases by structure determinations.

Journal Article↗

Multifunctional Ligands. Phosphinimine-Substituted Cyanofluoroaromatics Including X-ray Molecular Structures of Three Representative Ligands 4,6-(CN)(2)C(6)F(2)-1,3-(N=PPh(3))(2), 4,6-(CN)(2)C(6)F(2)-1,3-(N=PPh(2)Me)(2) and 4,6-(CN)(2)C(6)F(2)-1-(N=PPh(3))-3-(N=PPh(2)Me). Formation of Rhodium(I) Complexes.

Reaction of 1,3-dicyanotetrafluorobenzene with 2 equiv of (trimethylsilyl)iminophosphoranes gave the disubstituted derivatives 4,6-(CN)(2)C(6)F(2)-1,3-AB: 1, A = B = (N=PPh(3)); 2, A = B = (N=PPh(2)Me); and 3, A = (N=PPh(3)), B = (N=PPh(2)Me). Monosubstituted compounds of the type 2,4-(CN)(2)C(6)F(3)-1-A; notably 4, A = (N=PPh(3)), and 5, A = (N=PPh(2)Me), were readily obtained by reaction of 1 molar equiv of the silylated iminophosphorane with the cyanofluoro aromatic. Substitution of the fluorine para to the CN group(s) occurs in all cases. Reactions of 1,2- and 1,4-dicyanotetrafluorobenzene with (trimethylsilyl)iminophosphoranes gave only monosubstituted derivatives 3,4-(CN)(2)C(6)F(3)-1-A (6, A = (N=PPh(3)), and 7, A = (N=PPh(2)Me)) and 2,5-(CN)(2)C(6)F(3)-1-A (8, A = (N=PPh(3)), and 9, A = (N=PPh(2)Me)), respectively, as the result of electronic deactivation of the second substitutional point. 1, 4,6-(CN)(2)C(6)F(2)-1,3-(N=PPh(3)), 2, 4,6-(CN)(2)C(6)F(2)-1,3-(N=PPh(2)Me)(2), and 3, 4,6-(CN)(2)C(6)F(2)-1-(N=PPh(3))-3-(N=PPh(2)Me) have been structurally characterized. For 1 (at 21 degrees C), monoclinic, C2/(c) (No. 15), a = 15.289(2) Å, b = 10.196(1) Å, c = 23.491(6) Å, beta = 91.63(2) degrees, V = 3660(2) Å(3), and Z = 4. The P=N bond length is 1.579(2) Å and the P(V)-N-C(phenyl) angle is 134.0(2) degrees. For 2, (at 21 degrees C) monoclinic, C2/(c) (No. 15), a = 18.694(2) Å, b = 8.576(1) Å, c = 40.084(4) Å, beta = 94.00(1) degrees, V = 6411(2) Å(3), and Z = 8. The P(1)=N(1) bond length is 1.570(4) Å, the P(2)=N(2) bond length is 1.589(3) Å, the P(1)-N(1)-C(14) angle is 131.6(3) degrees, and the P(2)-N(2)-C(16) angle is 131.3(3) degrees. For 3, (at -80 degrees C) monoclinic, P2(1)/c (No. 14), a = 9.210(1) Å, b = 18.113(2) Å, c = 20.015(2) Å, beta = 100.07(1) degrees, V = 3287(2) Å(3), and Z = 4. The P(1)=N(1) bond length (PPh(3) group) is 1.567(4) Å, the P(2)=N(2) bond length (PPh(2)Me group) is 1.581(5) Å, the P(1)-N(1)-C(1) angle is 140.4(4) degrees, and the P(2)-N(2)-C(3) angle is 129.4(4) degrees. These new multifunctional chelating ligands readily react with [Rh(cod)Cl](2) and AgClO(4) to give cationic Rh(I) complexes in which the imine and/or the nitrile groups are coordinated to the Rh center.

Journal Article↗

Selective Azide Oxidation of 1,2-Bis(diphenylphosphino)benzene and Related Ethylenebis(phosphines) to Asymmetric Multifunctional Phosphorus Ligands and Formation of Rhodium(I) Complexes of These Ligands. Structural Characterization of the Prototypical Ligand 1-(((Trimethylsilyl)imino)diphenylphosphorano)-2-(diphenylphosphino)benzene and Its Rhodium(I) Complex: 1-Ph(2)P=N(SiMe(3))C(6)H(4)-2-(Ph(2)P)Rh(CO)Cl.

Selective azide mono-oxidation of o-bis(phosphines) such as o-bis(diphenylphosphino)benzene and other bis(phosphines) with cis-substituents on a rigid backbone such as an ethylene structure occurs as the result of the steric control exerted during the azide oxidation (Staudinger) reaction process. The azides used were the trimethylsilyl, 4-cyanotetrafluorophenyl, benzyl, and diphenoxyphosphonyl azides. The prototypical ligand 1-Ph(2)P=N(SiMe(3))-2-(Ph(2)P)C(6)H(4), 2, has been structurally characterized. Crystal data for 2: crystal dimensions, 0.38 x 0.38 x 0.57 mm; space group, monoclinic, P2(1)/c, (No. 14); a = 11.093(5) Å, b = 14.898(5) Å, c = 18.811(2) Å, beta = 102.76(2) degrees, V = 3031 Å(3), Z = 4. Final R, R(w) and GOF values were 0.068, 0.074, and 1.92 respectively. The P=N-SiMe(3) angle was wide, 152.7(3) degrees, and the P=N bond length short (1.529(5) Å) relative to arylated iminophosphoranes but in keeping with the trends for silylated analogs. The iminophosphorane center can be selectively transformed with other agents in a Wittig type reaction converting the azides to the monooxide, monosulfide, etc. The iminophosphoranophosphines are also good complexing agents and the Rh(I) complex derived from 2, 1-Ph(2)P=N(SiMe(3))-C(6)H(4)-2-(Ph(2)P)Rh(CO)Cl, 15 was structurally characterized. Crystal data for 15: crystal dimensions, 0.32 x 0.44 x 0.66 mm; space group, monoclinic, P2(1)/c (No. 14); a = 13.793(3) Å, b = 12.622(11) Å, c = 20.436(6) Å, beta = 105.93(2) degrees, V = 3421.2 Å(3), Z = 4. Final R, R(w), and GOF values were 0.064, 0.061, and 1.45 respectively. The complex shows typical square planar geometry about Rh, a cis phosphine-CO relationship, and no exceptional steric crowding of the coordination site.

Journal Article↗

Hexacoordinate Phosphorus. 7. Synthesis and Characterization of Neutral Phosphorus(V) Compounds Containing Divalent Tridentate Diphenol Imine, Azo, and Thio Ligands.

The reactions of bis(trimethylsilyl)ated forms of the Schiff base ligands N-(2-hydroxyphenyl)salicylideneamine {(HO)C(6)H(4)N(CH)C(6)H(4)(OH)}, N-(4-tert-butyl-2-hydroxyphenyl)salicylideneamine {(HO)((t)Bu)C(6)H(3)N(CH)C(6)H(4)(OH)}, N-(2-hydroxy-4-nitrophenyl)salicylideneamine {(HO)(O(2)N)C(6)H(3)N(CH)C(6)H(4)(OH)}, and the structurally related ligand 2,2'-azophenol with halogeno- and (trifluoromethyl)halogenophosphoranes yield a series of neutral hexacoordinate phosphorus(V) compounds by means of trimethylsilyl halide elimination. In all of these cases the ligands chelate in a meridional conformation in which bicyclic five- and six-membered chelate rings are formed through structures containing two phenolic P-O bonds and one N-P bond. The hexacoordinate nature of these compounds is evidenced by their high-field (31)P NMR chemical shifts and their characteristic J(PF) coupling patterns and is further substantiated by the crystal structures of {O((t)Bu)C(6)H(3)N(CH)C(6)H(4)O}PCl(3) and {OC(6)H(4)N=NC(6)H(4)O}PF(3). Crystal data for {O((t)Bu)C(6)H(3)N(CH)C(6)H(4)O}PCl(3): triclinic, space group P&onemacr; (No. 2), a = 11.167(1) Å, b = 15.684(1) Å, c = 17.047(2) Å, V = 2840(1) Å(3), Z = 2. Final R and R(w) values were 0.051 and 0.079, respectively. Crystal data for {OC(6)H(4)N=NC(6)H(4)O}PF(3): monoclinic, space group P2(1)/c (No. 14), a = 6.9393(8) Å, b = 12.450(2) Å, c = 13.907(2) Å, V = 1190.7(6) Å(3), Z = 4. Final R and R(w) values were 0.045 and 0.056, respectively. The molecular structures of {O((t)Bu)C(6)H(3)N(CH)C(6)H(4)O}PCl(3) and {OC(6)H(4)N=NC(6)H(4)O}PF(3) show that in both cases the Schiff base ligand chelates occupy the meridional plane about the six-coordinate phosphorus atom. In the case of {OC(6)H(4)N=NC(6)H(4)O}PF(3) the equivalent nitrogen atoms in the chelate rings are disordered to form half-occupancy pairs. The silylated form of the related thiobis(phenol), 2,2'-thiobis(4,6-tert-butylphenol), reacted similarly with pentavalent halides to form the six-coordinate complex [{2-O-3,5-((t)Bu)(2)C(6)H(2)}(2)S]PCl(3) which was also verified by a crystal structure. Crystal data for [{2-O-3,5-((t)Bu)(2)C(6)H(2)}(2)S]PCl(3): monoclinic P2(1)/n, a = 13.989(2), b = 13.594(2), c = 16.483(2) Å, beta = 97.98(2) degrees, V = 3104(2) Å(3), Z = 4; final R and R(w)() values were 0.039 and 0.052, respectively. In contrast to the above six coordinate complexes, this compound possesses a facial structure in which two phenoxy substituents form planar chelates centered on the bridging sulfur and intersecting at the P-S axis. The P-S bond length, 2.331(1) Å, is slightly shorter than has been previously observed in the example wherein the ligand possesses two tert-butyl groups and the phosphorus carries three OCH(2)CF(3 )substituents indicating stronger interaction between P and S in the present case.

Journal Article↗